C16H19N3O7 — CID 5121827
5-ethoxy-N'-(3,4,5-trimethoxybenzoyl)-1,3-oxazole-2-carbohydrazide (PubChem CID 5121827) has the molecular formula C16H19N3O7 and a molecular weight of 365.34 g/mol. Its IUPAC name is 5-ethoxy-N'-(3,4,5-trimethoxybenzoyl)-1,3-oxazole-2-carbohydrazide.
| Compound Name | 5-ethoxy-N'-(3,4,5-trimethoxybenzoyl)-1,3-oxazole-2-carbohydrazide |
|---|---|
| PubChem CID | 5121827 |
| Molecular Formula | C16H19N3O7 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 5-ethoxy-N'-(3,4,5-trimethoxybenzoyl)-1,3-oxazole-2-carbohydrazide |
| SMILES | CCOc1cnc(C(=O)NNC(=O)c2cc(OC)c(OC)c(OC)c2)o1 |
| InChI | InChI=1S/C16H19N3O7/c1-5-25-12-8-17-16(26-12)15(21)19-18-14(20)9-6-10(22-2)13(24-4)11(7-9)23-3/h6-8H,5H2,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | HVWBVWFMYIGQCB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|