C28H28N4O2 — CID 90300464
N-(4-cyanophenyl)-N'-(9-ethylcarbazol-3-yl)-3,3-dimethylpentanediamide (PubChem CID 90300464) has the molecular formula C28H28N4O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is N-(4-cyanophenyl)-N'-(9-ethylcarbazol-3-yl)-3,3-dimethylpentanediamide.
| Compound Name | N-(4-cyanophenyl)-N'-(9-ethylcarbazol-3-yl)-3,3-dimethylpentanediamide |
|---|---|
| PubChem CID | 90300464 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | N-(4-cyanophenyl)-N'-(9-ethylcarbazol-3-yl)-3,3-dimethylpentanediamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)CC(C)(C)CC(=O)Nc3ccc(C#N)cc3)ccc21 |
| InChI | InChI=1S/C28H28N4O2/c1-4-32-24-8-6-5-7-22(24)23-15-21(13-14-25(23)32)31-27(34)17-28(2,3)16-26(33)30-20-11-9-19(18-29)10-12-20/h5-15H,4,16-17H2,1-3H3,(H,30,33)(H,31,34) |
| InChIKey | AWDLQRWCGUOKFJ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |