C27H26N4O2 — CID 86729719
N-(3-cyanophenyl)-N'-(9-ethylcarbazol-3-yl)-3-methylpentanediamide (PubChem CID 86729719) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is N-(3-cyanophenyl)-N'-(9-ethylcarbazol-3-yl)-3-methylpentanediamide.
| Compound Name | N-(3-cyanophenyl)-N'-(9-ethylcarbazol-3-yl)-3-methylpentanediamide |
|---|---|
| PubChem CID | 86729719 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | N-(3-cyanophenyl)-N'-(9-ethylcarbazol-3-yl)-3-methylpentanediamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)CC(C)CC(=O)Nc3cccc(C#N)c3)ccc21 |
| InChI | InChI=1S/C27H26N4O2/c1-3-31-24-10-5-4-9-22(24)23-16-21(11-12-25(23)31)30-27(33)14-18(2)13-26(32)29-20-8-6-7-19(15-20)17-28/h4-12,15-16,18H,3,13-14H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | UWPXJESMESKRED-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |