C29H26F3N3O2 — CID 159935099
6-[4-cyano-3-(trifluoromethyl)phenyl]-N-(9-ethylcarbazol-3-yl)-3-methyl-5-oxohexanamide (PubChem CID 159935099) has the molecular formula C29H26F3N3O2 and a molecular weight of 505.54 g/mol. Its IUPAC name is 6-[4-cyano-3-(trifluoromethyl)phenyl]-N-(9-ethylcarbazol-3-yl)-3-methyl-5-oxohexanamide.
| Compound Name | 6-[4-cyano-3-(trifluoromethyl)phenyl]-N-(9-ethylcarbazol-3-yl)-3-methyl-5-oxohexanamide |
|---|---|
| PubChem CID | 159935099 |
| Molecular Formula | C29H26F3N3O2 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 6-[4-cyano-3-(trifluoromethyl)phenyl]-N-(9-ethylcarbazol-3-yl)-3-methyl-5-oxohexanamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)CC(C)CC(=O)Cc3ccc(C#N)c(C(F)(F)F)c3)ccc21 |
| InChI | InChI=1S/C29H26F3N3O2/c1-3-35-26-7-5-4-6-23(26)24-16-21(10-11-27(24)35)34-28(37)13-18(2)12-22(36)14-19-8-9-20(17-33)25(15-19)29(30,31)32/h4-11,15-16,18H,3,12-14H2,1-2H3,(H,34,37) |
| InChIKey | OADLINMIOJGGHN-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 74.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |