C34H32N4O2 — CID 90300497
N-benzyl-N-(4-cyanophenyl)-N'-(9-ethylcarbazol-3-yl)-3-methylpentanediamide (PubChem CID 90300497) has the molecular formula C34H32N4O2 and a molecular weight of 528.66 g/mol. Its IUPAC name is N-benzyl-N-(4-cyanophenyl)-N'-(9-ethylcarbazol-3-yl)-3-methylpentanediamide.
| Compound Name | N-benzyl-N-(4-cyanophenyl)-N'-(9-ethylcarbazol-3-yl)-3-methylpentanediamide |
|---|---|
| PubChem CID | 90300497 |
| Molecular Formula | C34H32N4O2 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | N-benzyl-N-(4-cyanophenyl)-N'-(9-ethylcarbazol-3-yl)-3-methylpentanediamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)CC(C)CC(=O)N(Cc3ccccc3)c3ccc(C#N)cc3)ccc21 |
| InChI | InChI=1S/C34H32N4O2/c1-3-37-31-12-8-7-11-29(31)30-21-27(15-18-32(30)37)36-33(39)19-24(2)20-34(40)38(23-26-9-5-4-6-10-26)28-16-13-25(22-35)14-17-28/h4-18,21,24H,3,19-20,23H2,1-2H3,(H,36,39) |
| InChIKey | UPBPKIYAYJMZMM-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |