C26H29N3O3 — CID 4269823
N-(9-ethylcarbazol-3-yl)-3-methyl-N'-[(5-methylfuran-2-yl)methyl]pentanediamide (PubChem CID 4269823) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is N-(9-ethylcarbazol-3-yl)-3-methyl-N'-[(5-methylfuran-2-yl)methyl]pentanediamide.
| Compound Name | N-(9-ethylcarbazol-3-yl)-3-methyl-N'-[(5-methylfuran-2-yl)methyl]pentanediamide |
|---|---|
| PubChem CID | 4269823 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | N-(9-ethylcarbazol-3-yl)-3-methyl-N'-[(5-methylfuran-2-yl)methyl]pentanediamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)CC(C)CC(=O)NCc3ccc(C)o3)ccc21 |
| InChI | InChI=1S/C26H29N3O3/c1-4-29-23-8-6-5-7-21(23)22-15-19(10-12-24(22)29)28-26(31)14-17(2)13-25(30)27-16-20-11-9-18(3)32-20/h5-12,15,17H,4,13-14,16H2,1-3H3,(H,27,30)(H,28,31) |
| InChIKey | LKOSAURJHJLPRS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |