C25H22N4O2 — CID 90300485
N-(4-cyanophenyl)-N'-(9-ethylcarbazol-3-yl)butanediamide (PubChem CID 90300485) has the molecular formula C25H22N4O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is N-(4-cyanophenyl)-N'-(9-ethylcarbazol-3-yl)butanediamide.
| Compound Name | N-(4-cyanophenyl)-N'-(9-ethylcarbazol-3-yl)butanediamide |
|---|---|
| PubChem CID | 90300485 |
| Molecular Formula | C25H22N4O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | N-(4-cyanophenyl)-N'-(9-ethylcarbazol-3-yl)butanediamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)CCC(=O)Nc3ccc(C#N)cc3)ccc21 |
| InChI | InChI=1S/C25H22N4O2/c1-2-29-22-6-4-3-5-20(22)21-15-19(11-12-23(21)29)28-25(31)14-13-24(30)27-18-9-7-17(16-26)8-10-18/h3-12,15H,2,13-14H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | JPMOPOSAUITKLK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |