C29H31N4O2+ — CID 90300539
[5-(4-cyanoanilino)-3-methyl-5-oxopentanoyl]-(9-ethylcarbazol-3-yl)-dimethylazanium (PubChem CID 90300539) has the molecular formula C29H31N4O2+ and a molecular weight of 467.59 g/mol. Its IUPAC name is [5-(4-cyanoanilino)-3-methyl-5-oxopentanoyl]-(9-ethylcarbazol-3-yl)-dimethylazanium.
| Compound Name | [5-(4-cyanoanilino)-3-methyl-5-oxopentanoyl]-(9-ethylcarbazol-3-yl)-dimethylazanium |
|---|---|
| PubChem CID | 90300539 |
| Molecular Formula | C29H31N4O2+ |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | [5-(4-cyanoanilino)-3-methyl-5-oxopentanoyl]-(9-ethylcarbazol-3-yl)-dimethylazanium |
| SMILES | CCn1c2ccccc2c2cc([N+](C)(C)C(=O)CC(C)CC(=O)Nc3ccc(C#N)cc3)ccc21 |
| InChI | InChI=1S/C29H30N4O2/c1-5-32-26-9-7-6-8-24(26)25-18-23(14-15-27(25)32)33(3,4)29(35)17-20(2)16-28(34)31-22-12-10-21(19-30)11-13-22/h6-15,18,20H,5,16-17H2,1-4H3/p+1 |
| InChIKey | PRTOUSODZAECIG-UHFFFAOYSA-O |
| XLogP | 5.83 |
| TPSA | 74.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|