C31H31N3O — CID 4212364
1-[(9-ethylcarbazol-3-yl)methyl]-1-phenyl-3-(4-propan-2-ylphenyl)urea (PubChem CID 4212364) has the molecular formula C31H31N3O and a molecular weight of 461.61 g/mol. Its IUPAC name is 1-[(9-ethylcarbazol-3-yl)methyl]-1-phenyl-3-(4-propan-2-ylphenyl)urea.
| Compound Name | 1-[(9-ethylcarbazol-3-yl)methyl]-1-phenyl-3-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 4212364 |
| Molecular Formula | C31H31N3O |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | 1-[(9-ethylcarbazol-3-yl)methyl]-1-phenyl-3-(4-propan-2-ylphenyl)urea |
| SMILES | CCn1c2ccccc2c2cc(CN(C(=O)Nc3ccc(C(C)C)cc3)c3ccccc3)ccc21 |
| InChI | InChI=1S/C31H31N3O/c1-4-33-29-13-9-8-12-27(29)28-20-23(14-19-30(28)33)21-34(26-10-6-5-7-11-26)31(35)32-25-17-15-24(16-18-25)22(2)3/h5-20,22H,4,21H2,1-3H3,(H,32,35) |
| InChIKey | ZFXPXSVVKATMSG-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |