C20H24N2O2 — CID 99124071
(2S)-2-[(9-ethylcarbazol-3-yl)methylamino]-3-methylbutanoic acid (PubChem CID 99124071) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is (2S)-2-[(9-ethylcarbazol-3-yl)methylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[(9-ethylcarbazol-3-yl)methylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 99124071 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (2S)-2-[(9-ethylcarbazol-3-yl)methylamino]-3-methylbutanoic acid |
| SMILES | CCn1c2ccccc2c2cc(CN[C@H](C(=O)O)C(C)C)ccc21 |
| InChI | InChI=1S/C20H24N2O2/c1-4-22-17-8-6-5-7-15(17)16-11-14(9-10-18(16)22)12-21-19(13(2)3)20(23)24/h5-11,13,19,21H,4,12H2,1-3H3,(H,23,24)/t19-/m0/s1 |
| InChIKey | AVDYLVIHFPRLAX-IBGZPJMESA-N |
| XLogP | 4.01 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |