C22H23N3 — CID 32664036
(1S)-N-[(9-ethylcarbazol-3-yl)methyl]-1-pyridin-2-ylethanamine (PubChem CID 32664036) has the molecular formula C22H23N3 and a molecular weight of 329.45 g/mol. Its IUPAC name is (1S)-N-[(9-ethylcarbazol-3-yl)methyl]-1-pyridin-2-ylethanamine.
| Compound Name | (1S)-N-[(9-ethylcarbazol-3-yl)methyl]-1-pyridin-2-ylethanamine |
|---|---|
| PubChem CID | 32664036 |
| Molecular Formula | C22H23N3 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | (1S)-N-[(9-ethylcarbazol-3-yl)methyl]-1-pyridin-2-ylethanamine |
| SMILES | CCn1c2ccccc2c2cc(CN[C@@H](C)c3ccccn3)ccc21 |
| InChI | InChI=1S/C22H23N3/c1-3-25-21-10-5-4-8-18(21)19-14-17(11-12-22(19)25)15-24-16(2)20-9-6-7-13-23-20/h4-14,16,24H,3,15H2,1-2H3/t16-/m0/s1 |
| InChIKey | YYOFEZBGVTWQDK-INIZCTEOSA-N |
| XLogP | 5.06 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |