C31H31N3O2 — CID 3673901
1-[(9-ethylcarbazol-3-yl)methyl]-3-(3-methoxyphenyl)-1-(2-phenylethyl)urea (PubChem CID 3673901) has the molecular formula C31H31N3O2 and a molecular weight of 477.61 g/mol. Its IUPAC name is 1-[(9-ethylcarbazol-3-yl)methyl]-3-(3-methoxyphenyl)-1-(2-phenylethyl)urea.
| Compound Name | 1-[(9-ethylcarbazol-3-yl)methyl]-3-(3-methoxyphenyl)-1-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 3673901 |
| Molecular Formula | C31H31N3O2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 1-[(9-ethylcarbazol-3-yl)methyl]-3-(3-methoxyphenyl)-1-(2-phenylethyl)urea |
| SMILES | CCn1c2ccccc2c2cc(CN(CCc3ccccc3)C(=O)Nc3cccc(OC)c3)ccc21 |
| InChI | InChI=1S/C31H31N3O2/c1-3-34-29-15-8-7-14-27(29)28-20-24(16-17-30(28)34)22-33(19-18-23-10-5-4-6-11-23)31(35)32-25-12-9-13-26(21-25)36-2/h4-17,20-21H,3,18-19,22H2,1-2H3,(H,32,35) |
| InChIKey | CMMJZMBLJKWWBI-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |