C32H33N3O — CID 3905889
1-benzyl-1-[(9-ethylcarbazol-3-yl)methyl]-3-(4-propan-2-ylphenyl)urea (PubChem CID 3905889) has the molecular formula C32H33N3O and a molecular weight of 475.64 g/mol. Its IUPAC name is 1-benzyl-1-[(9-ethylcarbazol-3-yl)methyl]-3-(4-propan-2-ylphenyl)urea.
| Compound Name | 1-benzyl-1-[(9-ethylcarbazol-3-yl)methyl]-3-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 3905889 |
| Molecular Formula | C32H33N3O |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | 1-benzyl-1-[(9-ethylcarbazol-3-yl)methyl]-3-(4-propan-2-ylphenyl)urea |
| SMILES | CCn1c2ccccc2c2cc(CN(Cc3ccccc3)C(=O)Nc3ccc(C(C)C)cc3)ccc21 |
| InChI | InChI=1S/C32H33N3O/c1-4-35-30-13-9-8-12-28(30)29-20-25(14-19-31(29)35)22-34(21-24-10-6-5-7-11-24)32(36)33-27-17-15-26(16-18-27)23(2)3/h5-20,23H,4,21-22H2,1-3H3,(H,33,36) |
| InChIKey | AQANXBCGHCBYPT-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |