C19H21N3O7 — CID 155810557
2-hydroxy-N-[4-[[(3,4,5-trimethoxybenzoyl)amino]carbamoyl]phenyl]acetamide (PubChem CID 155810557) has the molecular formula C19H21N3O7 and a molecular weight of 403.39 g/mol. Its IUPAC name is 2-hydroxy-N-[4-[[(3,4,5-trimethoxybenzoyl)amino]carbamoyl]phenyl]acetamide.
| Compound Name | 2-hydroxy-N-[4-[[(3,4,5-trimethoxybenzoyl)amino]carbamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 155810557 |
| Molecular Formula | C19H21N3O7 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 2-hydroxy-N-[4-[[(3,4,5-trimethoxybenzoyl)amino]carbamoyl]phenyl]acetamide |
| SMILES | COc1cc(C(=O)NNC(=O)c2ccc(NC(=O)CO)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C19H21N3O7/c1-27-14-8-12(9-15(28-2)17(14)29-3)19(26)22-21-18(25)11-4-6-13(7-5-11)20-16(24)10-23/h4-9,23H,10H2,1-3H3,(H,20,24)(H,21,25)(H,22,26) |
| InChIKey | PRFABRKWWQJESC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|