C23H26N2O4 — CID 8755542
N-(3,4-diethoxyphenyl)-2-[[(S)-furan-2-yl(phenyl)methyl]amino]acetamide (PubChem CID 8755542) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is N-(3,4-diethoxyphenyl)-2-[[(S)-furan-2-yl(phenyl)methyl]amino]acetamide.
| Compound Name | N-(3,4-diethoxyphenyl)-2-[[(S)-furan-2-yl(phenyl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 8755542 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-(3,4-diethoxyphenyl)-2-[[(S)-furan-2-yl(phenyl)methyl]amino]acetamide |
| SMILES | CCOc1ccc(NC(=O)CN[C@@H](c2ccccc2)c2ccco2)cc1OCC |
| InChI | InChI=1S/C23H26N2O4/c1-3-27-19-13-12-18(15-21(19)28-4-2)25-22(26)16-24-23(20-11-8-14-29-20)17-9-6-5-7-10-17/h5-15,23-24H,3-4,16H2,1-2H3,(H,25,26)/t23-/m0/s1 |
| InChIKey | RFXPDPMVVOEGPQ-QHCPKHFHSA-N |
| XLogP | 4.39 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |