C19H25N3O2S — CID 9126293
N'-acetyl-2-[[(S)-[4-(2-methylpropyl)phenyl]-thiophen-2-ylmethyl]amino]acetohydrazide (PubChem CID 9126293) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is N'-acetyl-2-[[(S)-[4-(2-methylpropyl)phenyl]-thiophen-2-ylmethyl]amino]acetohydrazide.
| Compound Name | N'-acetyl-2-[[(S)-[4-(2-methylpropyl)phenyl]-thiophen-2-ylmethyl]amino]acetohydrazide |
|---|---|
| PubChem CID | 9126293 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N'-acetyl-2-[[(S)-[4-(2-methylpropyl)phenyl]-thiophen-2-ylmethyl]amino]acetohydrazide |
| SMILES | CC(=O)NNC(=O)CN[C@@H](c1ccc(CC(C)C)cc1)c1cccs1 |
| InChI | InChI=1S/C19H25N3O2S/c1-13(2)11-15-6-8-16(9-7-15)19(17-5-4-10-25-17)20-12-18(24)22-21-14(3)23/h4-10,13,19-20H,11-12H2,1-3H3,(H,21,23)(H,22,24)/t19-/m0/s1 |
| InChIKey | FLBFMJAQXLSBBJ-IBGZPJMESA-N |
| XLogP | 2.79 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|