C14H21N3O2 — CID 9132759
N'-acetyl-2-[[(1R)-2-methyl-1-phenylpropyl]amino]acetohydrazide (PubChem CID 9132759) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is N'-acetyl-2-[[(1R)-2-methyl-1-phenylpropyl]amino]acetohydrazide.
| Compound Name | N'-acetyl-2-[[(1R)-2-methyl-1-phenylpropyl]amino]acetohydrazide |
|---|---|
| PubChem CID | 9132759 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | N'-acetyl-2-[[(1R)-2-methyl-1-phenylpropyl]amino]acetohydrazide |
| SMILES | CC(=O)NNC(=O)CN[C@@H](c1ccccc1)C(C)C |
| InChI | InChI=1S/C14H21N3O2/c1-10(2)14(12-7-5-4-6-8-12)15-9-13(19)17-16-11(3)18/h4-8,10,14-15H,9H2,1-3H3,(H,16,18)(H,17,19)/t14-/m1/s1 |
| InChIKey | JGAQFGVLKYSQSZ-CQSZACIVSA-N |
| XLogP | 1.14 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|