C20H28N2O2 — CID 86911674
2-[[1-(4-ethylphenyl)-2-methylpropyl]amino]-N-[1-(furan-2-yl)ethyl]acetamide (PubChem CID 86911674) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 2-[[1-(4-ethylphenyl)-2-methylpropyl]amino]-N-[1-(furan-2-yl)ethyl]acetamide.
| Compound Name | 2-[[1-(4-ethylphenyl)-2-methylpropyl]amino]-N-[1-(furan-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 86911674 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 2-[[1-(4-ethylphenyl)-2-methylpropyl]amino]-N-[1-(furan-2-yl)ethyl]acetamide |
| SMILES | CCc1ccc(C(NCC(=O)NC(C)c2ccco2)C(C)C)cc1 |
| InChI | InChI=1S/C20H28N2O2/c1-5-16-8-10-17(11-9-16)20(14(2)3)21-13-19(23)22-15(4)18-7-6-12-24-18/h6-12,14-15,20-21H,5,13H2,1-4H3,(H,22,23) |
| InChIKey | KDUSNNAAMIXUME-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |