C16H14Cl3NO — CID 798501
(3R)-3-phenyl-N-(2,4,5-trichlorophenyl)butanamide (PubChem CID 798501) has the molecular formula C16H14Cl3NO and a molecular weight of 342.65 g/mol. Its IUPAC name is (3R)-3-phenyl-N-(2,4,5-trichlorophenyl)butanamide.
| Compound Name | (3R)-3-phenyl-N-(2,4,5-trichlorophenyl)butanamide |
|---|---|
| PubChem CID | 798501 |
| Molecular Formula | C16H14Cl3NO |
| Molecular Weight | 342.65 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | (3R)-3-phenyl-N-(2,4,5-trichlorophenyl)butanamide |
| SMILES | C[C@H](CC(=O)Nc1cc(Cl)c(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C16H14Cl3NO/c1-10(11-5-3-2-4-6-11)7-16(21)20-15-9-13(18)12(17)8-14(15)19/h2-6,8-10H,7H2,1H3,(H,20,21)/t10-/m1/s1 |
| InChIKey | HXRJFKWLCYGDFF-SNVBAGLBSA-N |
| XLogP | 5.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.65 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|