C13H15Cl2NO3 — CID 165130700
1-(3-chlorophenyl)ethyl N-(2-chloro-2-methylpropanoyl)carbamate (PubChem CID 165130700) has the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. Its IUPAC name is 1-(3-chlorophenyl)ethyl N-(2-chloro-2-methylpropanoyl)carbamate.
| Compound Name | 1-(3-chlorophenyl)ethyl N-(2-chloro-2-methylpropanoyl)carbamate |
|---|---|
| PubChem CID | 165130700 |
| Molecular Formula | C13H15Cl2NO3 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 1-(3-chlorophenyl)ethyl N-(2-chloro-2-methylpropanoyl)carbamate |
| SMILES | CC(OC(=O)NC(=O)C(C)(C)Cl)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2NO3/c1-8(9-5-4-6-10(14)7-9)19-12(18)16-11(17)13(2,3)15/h4-8H,1-3H3,(H,16,17,18) |
| InChIKey | CEPSESJDGSDCHP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|