C22H21ClFN2O+ — CID 9307429
[(1R)-1-(3-chlorophenyl)ethyl]-[(1S)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl]azanium (PubChem CID 9307429) has the molecular formula C22H21ClFN2O+ and a molecular weight of 383.87 g/mol. Its IUPAC name is [(1R)-1-(3-chlorophenyl)ethyl]-[(1S)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl]azanium.
| Compound Name | [(1R)-1-(3-chlorophenyl)ethyl]-[(1S)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 9307429 |
| Molecular Formula | C22H21ClFN2O+ |
| Molecular Weight | 383.87 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | [(1R)-1-(3-chlorophenyl)ethyl]-[(1S)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl]azanium |
| SMILES | C[C@@H]([NH2+][C@H](C(=O)Nc1ccc(F)cc1)c1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H20ClFN2O/c1-15(17-8-5-9-18(23)14-17)25-21(16-6-3-2-4-7-16)22(27)26-20-12-10-19(24)11-13-20/h2-15,21,25H,1H3,(H,26,27)/p+1/t15-,21+/m1/s1 |
| InChIKey | RFRUZAQTZIUZIA-VFNWGFHPSA-O |
| XLogP | 4.48 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.87 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |