C19H18FN2O2+ — CID 7986750
[(1S)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl]-(furan-2-ylmethyl)azanium (PubChem CID 7986750) has the molecular formula C19H18FN2O2+ and a molecular weight of 325.36 g/mol. Its IUPAC name is [(1S)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl]-(furan-2-ylmethyl)azanium.
| Compound Name | [(1S)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl]-(furan-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 7986750 |
| Molecular Formula | C19H18FN2O2+ |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | [(1S)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl]-(furan-2-ylmethyl)azanium |
| SMILES | O=C(Nc1ccc(F)cc1)[C@@H]([NH2+]Cc1ccco1)c1ccccc1 |
| InChI | InChI=1S/C19H17FN2O2/c20-15-8-10-16(11-9-15)22-19(23)18(14-5-2-1-3-6-14)21-13-17-7-4-12-24-17/h1-12,18,21H,13H2,(H,22,23)/p+1/t18-/m0/s1 |
| InChIKey | UGDPFDLLUPYEHU-SFHVURJKSA-O |
| XLogP | 2.86 |
| TPSA | 58.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |