C15H15ClN2O4 — CID 7320147
(3R)-4-(4-chloroanilino)-3-(furan-2-ylmethylazaniumyl)-4-oxobutanoate (PubChem CID 7320147) has the molecular formula C15H15ClN2O4 and a molecular weight of 322.75 g/mol. Its IUPAC name is (3R)-4-(4-chloroanilino)-3-(furan-2-ylmethylazaniumyl)-4-oxobutanoate.
| Compound Name | (3R)-4-(4-chloroanilino)-3-(furan-2-ylmethylazaniumyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7320147 |
| Molecular Formula | C15H15ClN2O4 |
| Molecular Weight | 322.75 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | (3R)-4-(4-chloroanilino)-3-(furan-2-ylmethylazaniumyl)-4-oxobutanoate |
| SMILES | O=C([O-])C[C@@H]([NH2+]Cc1ccco1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H15ClN2O4/c16-10-3-5-11(6-4-10)18-15(21)13(8-14(19)20)17-9-12-2-1-7-22-12/h1-7,13,17H,8-9H2,(H,18,21)(H,19,20)/t13-/m1/s1 |
| InChIKey | YJZZEUFDIYMTON-CYBMUJFWSA-N |
| XLogP | 0.14 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.75 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |