C10H12NO5- — CID 7018217
(2S)-2-(furan-2-ylmethylazaniumyl)pentanedioate (PubChem CID 7018217) has the molecular formula C10H12NO5- and a molecular weight of 226.21 g/mol. Its IUPAC name is (2S)-2-(furan-2-ylmethylazaniumyl)pentanedioate.
| Compound Name | (2S)-2-(furan-2-ylmethylazaniumyl)pentanedioate |
|---|---|
| PubChem CID | 7018217 |
| Molecular Formula | C10H12NO5- |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | (2S)-2-(furan-2-ylmethylazaniumyl)pentanedioate |
| SMILES | O=C([O-])CC[C@H]([NH2+]Cc1ccco1)C(=O)[O-] |
| InChI | InChI=1S/C10H13NO5/c12-9(13)4-3-8(10(14)15)11-6-7-2-1-5-16-7/h1-2,5,8,11H,3-4,6H2,(H,12,13)(H,14,15)/p-1/t8-/m0/s1 |
| InChIKey | MHDOZIRRVSFXSE-QMMMGPOBSA-M |
| XLogP | -3.01 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |