C16H18N2O4 — CID 7460513
(3S)-3-(furan-2-ylmethylazaniumyl)-4-(N-methylanilino)-4-oxobutanoate (PubChem CID 7460513) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is (3S)-3-(furan-2-ylmethylazaniumyl)-4-(N-methylanilino)-4-oxobutanoate.
| Compound Name | (3S)-3-(furan-2-ylmethylazaniumyl)-4-(N-methylanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 7460513 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (3S)-3-(furan-2-ylmethylazaniumyl)-4-(N-methylanilino)-4-oxobutanoate |
| SMILES | CN(C(=O)[C@H](CC(=O)[O-])[NH2+]Cc1ccco1)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O4/c1-18(12-6-3-2-4-7-12)16(21)14(10-15(19)20)17-11-13-8-5-9-22-13/h2-9,14,17H,10-11H2,1H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | VDVCXXAPNWWKIR-AWEZNQCLSA-N |
| XLogP | -0.49 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |