C21H19N2O2+ — CID 9325925
furan-2-ylmethyl-[(1R)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]azanium (PubChem CID 9325925) has the molecular formula C21H19N2O2+ and a molecular weight of 331.40 g/mol. Its IUPAC name is furan-2-ylmethyl-[(1R)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]azanium.
| Compound Name | furan-2-ylmethyl-[(1R)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 9325925 |
| Molecular Formula | C21H19N2O2+ |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | furan-2-ylmethyl-[(1R)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]azanium |
| SMILES | O=C(c1c[nH]c2ccccc12)[C@H]([NH2+]Cc1ccco1)c1ccccc1 |
| InChI | InChI=1S/C21H18N2O2/c24-21(18-14-22-19-11-5-4-10-17(18)19)20(15-7-2-1-3-8-15)23-13-16-9-6-12-25-16/h1-12,14,20,22-23H,13H2/p+1/t20-/m1/s1 |
| InChIKey | FUZMQOKOFRJFEQ-HXUWFJFHSA-O |
| XLogP | 3.45 |
| TPSA | 62.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |