C20H22N3O2+ — CID 9356616
2-acetamidoethyl-[(1R)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]azanium (PubChem CID 9356616) has the molecular formula C20H22N3O2+ and a molecular weight of 336.42 g/mol. Its IUPAC name is 2-acetamidoethyl-[(1R)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]azanium.
| Compound Name | 2-acetamidoethyl-[(1R)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 9356616 |
| Molecular Formula | C20H22N3O2+ |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2-acetamidoethyl-[(1R)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]azanium |
| SMILES | CC(=O)NCC[NH2+][C@@H](C(=O)c1c[nH]c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C20H21N3O2/c1-14(24)21-11-12-22-19(15-7-3-2-4-8-15)20(25)17-13-23-18-10-6-5-9-16(17)18/h2-10,13,19,22-23H,11-12H2,1H3,(H,21,24)/p+1/t19-/m1/s1 |
| InChIKey | RTOMLNIDAYBZMO-LJQANCHMSA-O |
| XLogP | 1.79 |
| TPSA | 78.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|