C26H25ClN2O — CID 139422950
2-[[(2R)-2-(4-chlorophenyl)butyl]amino]-1-(1H-indol-3-yl)-2-phenylethanone (PubChem CID 139422950) has the molecular formula C26H25ClN2O and a molecular weight of 416.95 g/mol. Its IUPAC name is 2-[[(2R)-2-(4-chlorophenyl)butyl]amino]-1-(1H-indol-3-yl)-2-phenylethanone.
| Compound Name | 2-[[(2R)-2-(4-chlorophenyl)butyl]amino]-1-(1H-indol-3-yl)-2-phenylethanone |
|---|---|
| PubChem CID | 139422950 |
| Molecular Formula | C26H25ClN2O |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 2-[[(2R)-2-(4-chlorophenyl)butyl]amino]-1-(1H-indol-3-yl)-2-phenylethanone |
| SMILES | CC[C@@H](CNC(C(=O)c1c[nH]c2ccccc12)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H25ClN2O/c1-2-18(19-12-14-21(27)15-13-19)16-29-25(20-8-4-3-5-9-20)26(30)23-17-28-24-11-7-6-10-22(23)24/h3-15,17-18,25,28-29H,2,16H2,1H3/t18-,25?/m0/s1 |
| InChIKey | JPMMURHQOGIGCI-CPFIQGLUSA-N |
| XLogP | 6.53 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |