C28H29N3O — CID 31444734
(2R)-1-(1H-indol-3-yl)-2-phenyl-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methylamino]ethanone (PubChem CID 31444734) has the molecular formula C28H29N3O and a molecular weight of 423.56 g/mol. Its IUPAC name is (2R)-1-(1H-indol-3-yl)-2-phenyl-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methylamino]ethanone.
| Compound Name | (2R)-1-(1H-indol-3-yl)-2-phenyl-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methylamino]ethanone |
|---|---|
| PubChem CID | 31444734 |
| Molecular Formula | C28H29N3O |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | (2R)-1-(1H-indol-3-yl)-2-phenyl-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methylamino]ethanone |
| SMILES | O=C(c1c[nH]c2ccccc12)[C@H](NCc1ccc(CN2CCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H29N3O/c32-28(25-19-29-26-11-5-4-10-24(25)26)27(23-8-2-1-3-9-23)30-18-21-12-14-22(15-13-21)20-31-16-6-7-17-31/h1-5,8-15,19,27,29-30H,6-7,16-18,20H2/t27-/m1/s1 |
| InChIKey | DIBYVCTXLCRNOC-HHHXNRCGSA-N |
| XLogP | 5.48 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |