C25H21F3N2O — CID 139422939
(2S)-1-(1H-indol-3-yl)-2-phenyl-2-[2-[4-(trifluoromethyl)phenyl]ethylamino]ethanone (PubChem CID 139422939) has the molecular formula C25H21F3N2O and a molecular weight of 422.45 g/mol. Its IUPAC name is (2S)-1-(1H-indol-3-yl)-2-phenyl-2-[2-[4-(trifluoromethyl)phenyl]ethylamino]ethanone.
| Compound Name | (2S)-1-(1H-indol-3-yl)-2-phenyl-2-[2-[4-(trifluoromethyl)phenyl]ethylamino]ethanone |
|---|---|
| PubChem CID | 139422939 |
| Molecular Formula | C25H21F3N2O |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | (2S)-1-(1H-indol-3-yl)-2-phenyl-2-[2-[4-(trifluoromethyl)phenyl]ethylamino]ethanone |
| SMILES | O=C(c1c[nH]c2ccccc12)[C@@H](NCCc1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H21F3N2O/c26-25(27,28)19-12-10-17(11-13-19)14-15-29-23(18-6-2-1-3-7-18)24(31)21-16-30-22-9-5-4-8-20(21)22/h1-13,16,23,29-30H,14-15H2/t23-/m0/s1 |
| InChIKey | OZINEDLQSVHCQV-QHCPKHFHSA-N |
| XLogP | 5.94 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |