C31H27FN2O2 — CID 139422927
(2S)-2-[2-(4-fluorophenyl)ethylamino]-2-phenyl-1-(6-phenylmethoxy-1H-indol-3-yl)ethanone (PubChem CID 139422927) has the molecular formula C31H27FN2O2 and a molecular weight of 478.57 g/mol. Its IUPAC name is (2S)-2-[2-(4-fluorophenyl)ethylamino]-2-phenyl-1-(6-phenylmethoxy-1H-indol-3-yl)ethanone.
| Compound Name | (2S)-2-[2-(4-fluorophenyl)ethylamino]-2-phenyl-1-(6-phenylmethoxy-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 139422927 |
| Molecular Formula | C31H27FN2O2 |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | (2S)-2-[2-(4-fluorophenyl)ethylamino]-2-phenyl-1-(6-phenylmethoxy-1H-indol-3-yl)ethanone |
| SMILES | O=C(c1c[nH]c2cc(OCc3ccccc3)ccc12)[C@@H](NCCc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H27FN2O2/c32-25-13-11-22(12-14-25)17-18-33-30(24-9-5-2-6-10-24)31(35)28-20-34-29-19-26(15-16-27(28)29)36-21-23-7-3-1-4-8-23/h1-16,19-20,30,33-34H,17-18,21H2/t30-/m0/s1 |
| InChIKey | ZNXYZQDUGFGSAC-PMERELPUSA-N |
| XLogP | 6.64 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |