C25H23ClN2O — CID 158771521
(2R)-2-[2-(2-chloro-4-methylphenyl)ethylamino]-1-(1H-indol-3-yl)-2-phenylethanone (PubChem CID 158771521) has the molecular formula C25H23ClN2O and a molecular weight of 402.93 g/mol. Its IUPAC name is (2R)-2-[2-(2-chloro-4-methylphenyl)ethylamino]-1-(1H-indol-3-yl)-2-phenylethanone.
| Compound Name | (2R)-2-[2-(2-chloro-4-methylphenyl)ethylamino]-1-(1H-indol-3-yl)-2-phenylethanone |
|---|---|
| PubChem CID | 158771521 |
| Molecular Formula | C25H23ClN2O |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (2R)-2-[2-(2-chloro-4-methylphenyl)ethylamino]-1-(1H-indol-3-yl)-2-phenylethanone |
| SMILES | Cc1ccc(CCN[C@@H](C(=O)c2c[nH]c3ccccc23)c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C25H23ClN2O/c1-17-11-12-18(22(26)15-17)13-14-27-24(19-7-3-2-4-8-19)25(29)21-16-28-23-10-6-5-9-20(21)23/h2-12,15-16,24,27-28H,13-14H2,1H3/t24-/m1/s1 |
| InChIKey | BMJVRTYHGMNQBN-XMMPIXPASA-N |
| XLogP | 5.89 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |