C26H26N2O — CID 4851610
1-(7-ethyl-1H-indol-3-yl)-2-[(4-methylphenyl)methylamino]-2-phenylethanone (PubChem CID 4851610) has the molecular formula C26H26N2O and a molecular weight of 382.51 g/mol. Its IUPAC name is 1-(7-ethyl-1H-indol-3-yl)-2-[(4-methylphenyl)methylamino]-2-phenylethanone.
| Compound Name | 1-(7-ethyl-1H-indol-3-yl)-2-[(4-methylphenyl)methylamino]-2-phenylethanone |
|---|---|
| PubChem CID | 4851610 |
| Molecular Formula | C26H26N2O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 1-(7-ethyl-1H-indol-3-yl)-2-[(4-methylphenyl)methylamino]-2-phenylethanone |
| SMILES | CCc1cccc2c(C(=O)C(NCc3ccc(C)cc3)c3ccccc3)c[nH]c12 |
| InChI | InChI=1S/C26H26N2O/c1-3-20-10-7-11-22-23(17-28-24(20)22)26(29)25(21-8-5-4-6-9-21)27-16-19-14-12-18(2)13-15-19/h4-15,17,25,27-28H,3,16H2,1-2H3 |
| InChIKey | XHVQPYTXDPJGQI-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |