C23H25NOS — CID 7599104
(2S)-2-cyclopentylsulfanyl-1-(7-ethyl-1H-indol-3-yl)-2-phenylethanone (PubChem CID 7599104) has the molecular formula C23H25NOS and a molecular weight of 363.53 g/mol. Its IUPAC name is (2S)-2-cyclopentylsulfanyl-1-(7-ethyl-1H-indol-3-yl)-2-phenylethanone.
| Compound Name | (2S)-2-cyclopentylsulfanyl-1-(7-ethyl-1H-indol-3-yl)-2-phenylethanone |
|---|---|
| PubChem CID | 7599104 |
| Molecular Formula | C23H25NOS |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | (2S)-2-cyclopentylsulfanyl-1-(7-ethyl-1H-indol-3-yl)-2-phenylethanone |
| SMILES | CCc1cccc2c(C(=O)[C@@H](SC3CCCC3)c3ccccc3)c[nH]c12 |
| InChI | InChI=1S/C23H25NOS/c1-2-16-11-8-14-19-20(15-24-21(16)19)22(25)23(17-9-4-3-5-10-17)26-18-12-6-7-13-18/h3-5,8-11,14-15,18,23-24H,2,6-7,12-13H2,1H3/t23-/m0/s1 |
| InChIKey | GXFWSIOGIRYVJS-QHCPKHFHSA-N |
| XLogP | 6.33 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |