C26H23NO3 — CID 7718003
[(1S)-2-(7-ethyl-1H-indol-3-yl)-2-oxo-1-phenylethyl] 2-methylbenzoate (PubChem CID 7718003) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is [(1S)-2-(7-ethyl-1H-indol-3-yl)-2-oxo-1-phenylethyl] 2-methylbenzoate.
| Compound Name | [(1S)-2-(7-ethyl-1H-indol-3-yl)-2-oxo-1-phenylethyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 7718003 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | [(1S)-2-(7-ethyl-1H-indol-3-yl)-2-oxo-1-phenylethyl] 2-methylbenzoate |
| SMILES | CCc1cccc2c(C(=O)[C@@H](OC(=O)c3ccccc3C)c3ccccc3)c[nH]c12 |
| InChI | InChI=1S/C26H23NO3/c1-3-18-13-9-15-21-22(16-27-23(18)21)24(28)25(19-11-5-4-6-12-19)30-26(29)20-14-8-7-10-17(20)2/h4-16,25,27H,3H2,1-2H3/t25-/m0/s1 |
| InChIKey | AURZJGUIMVRDSY-VWLOTQADSA-N |
| XLogP | 5.82 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |