C28H26N2O5 — CID 25377470
[(1S)-2-(7-ethyl-1H-indol-3-yl)-2-oxo-1-phenylethyl] 2-[(Z)-(4-methoxyphenyl)methylideneamino]oxyacetate (PubChem CID 25377470) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is [(1S)-2-(7-ethyl-1H-indol-3-yl)-2-oxo-1-phenylethyl] 2-[(Z)-(4-methoxyphenyl)methylideneamino]oxyacetate.
| Compound Name | [(1S)-2-(7-ethyl-1H-indol-3-yl)-2-oxo-1-phenylethyl] 2-[(Z)-(4-methoxyphenyl)methylideneamino]oxyacetate |
|---|---|
| PubChem CID | 25377470 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | [(1S)-2-(7-ethyl-1H-indol-3-yl)-2-oxo-1-phenylethyl] 2-[(Z)-(4-methoxyphenyl)methylideneamino]oxyacetate |
| SMILES | CCc1cccc2c(C(=O)[C@@H](OC(=O)CO/N=C\c3ccc(OC)cc3)c3ccccc3)c[nH]c12 |
| InChI | InChI=1S/C28H26N2O5/c1-3-20-10-7-11-23-24(17-29-26(20)23)27(32)28(21-8-5-4-6-9-21)35-25(31)18-34-30-16-19-12-14-22(33-2)15-13-19/h4-17,28-29H,3,18H2,1-2H3/b30-16-/t28-/m0/s1 |
| InChIKey | VEXOYIQUNGCBMN-DDKUOGIBSA-N |
| XLogP | 5.26 |
| TPSA | 89.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|