C25H23NOS — CID 7599064
(2S)-2-benzylsulfanyl-1-(7-ethyl-1H-indol-3-yl)-2-phenylethanone (PubChem CID 7599064) has the molecular formula C25H23NOS and a molecular weight of 385.53 g/mol. Its IUPAC name is (2S)-2-benzylsulfanyl-1-(7-ethyl-1H-indol-3-yl)-2-phenylethanone.
| Compound Name | (2S)-2-benzylsulfanyl-1-(7-ethyl-1H-indol-3-yl)-2-phenylethanone |
|---|---|
| PubChem CID | 7599064 |
| Molecular Formula | C25H23NOS |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (2S)-2-benzylsulfanyl-1-(7-ethyl-1H-indol-3-yl)-2-phenylethanone |
| SMILES | CCc1cccc2c(C(=O)[C@@H](SCc3ccccc3)c3ccccc3)c[nH]c12 |
| InChI | InChI=1S/C25H23NOS/c1-2-19-14-9-15-21-22(16-26-23(19)21)24(27)25(20-12-7-4-8-13-20)28-17-18-10-5-3-6-11-18/h3-16,25-26H,2,17H2,1H3/t25-/m0/s1 |
| InChIKey | ZGJRZYFBBVPQID-VWLOTQADSA-N |
| XLogP | 6.59 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |