C18H16FNO — CID 43339295
1-(7-ethyl-1H-indol-3-yl)-2-(4-fluorophenyl)ethanone (PubChem CID 43339295) has the molecular formula C18H16FNO and a molecular weight of 281.33 g/mol. Its IUPAC name is 1-(7-ethyl-1H-indol-3-yl)-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-(7-ethyl-1H-indol-3-yl)-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 43339295 |
| Molecular Formula | C18H16FNO |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-(7-ethyl-1H-indol-3-yl)-2-(4-fluorophenyl)ethanone |
| SMILES | CCc1cccc2c(C(=O)Cc3ccc(F)cc3)c[nH]c12 |
| InChI | InChI=1S/C18H16FNO/c1-2-13-4-3-5-15-16(11-20-18(13)15)17(21)10-12-6-8-14(19)9-7-12/h3-9,11,20H,2,10H2,1H3 |
| InChIKey | NEQVMVSVFHMKTP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |