C23H22FN3O3 — CID 7181283
(5R)-5-ethyl-3-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione (PubChem CID 7181283) has the molecular formula C23H22FN3O3 and a molecular weight of 407.45 g/mol. Its IUPAC name is (5R)-5-ethyl-3-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-ethyl-3-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7181283 |
| Molecular Formula | C23H22FN3O3 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | (5R)-5-ethyl-3-[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione |
| SMILES | CCc1cccc2c(C(=O)CN3C(=O)N[C@](CC)(c4ccc(F)cc4)C3=O)c[nH]c12 |
| InChI | InChI=1S/C23H22FN3O3/c1-3-14-6-5-7-17-18(12-25-20(14)17)19(28)13-27-21(29)23(4-2,26-22(27)30)15-8-10-16(24)11-9-15/h5-12,25H,3-4,13H2,1-2H3,(H,26,30)/t23-/m1/s1 |
| InChIKey | OPANGKOKAQKTJM-HSZRJFAPSA-N |
| XLogP | 3.91 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|