C26H27N3O4S — CID 55571935
N-[5-[[2-(7-ethyl-1H-indol-3-yl)-2-oxo-1-phenylethyl]amino]-2-methoxyphenyl]methanesulfonamide (PubChem CID 55571935) has the molecular formula C26H27N3O4S and a molecular weight of 477.59 g/mol. Its IUPAC name is N-[5-[[2-(7-ethyl-1H-indol-3-yl)-2-oxo-1-phenylethyl]amino]-2-methoxyphenyl]methanesulfonamide.
| Compound Name | N-[5-[[2-(7-ethyl-1H-indol-3-yl)-2-oxo-1-phenylethyl]amino]-2-methoxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 55571935 |
| Molecular Formula | C26H27N3O4S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-[5-[[2-(7-ethyl-1H-indol-3-yl)-2-oxo-1-phenylethyl]amino]-2-methoxyphenyl]methanesulfonamide |
| SMILES | CCc1cccc2c(C(=O)C(Nc3ccc(OC)c(NS(C)(=O)=O)c3)c3ccccc3)c[nH]c12 |
| InChI | InChI=1S/C26H27N3O4S/c1-4-17-11-8-12-20-21(16-27-24(17)20)26(30)25(18-9-6-5-7-10-18)28-19-13-14-23(33-2)22(15-19)29-34(3,31)32/h5-16,25,27-29H,4H2,1-3H3 |
| InChIKey | CZSNACUUKDNWIQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|