C15H25N3O4S — CID 51725386
(2R)-2-[3-(methanesulfonamido)-4-methoxyanilino]-N-(2-methylpropyl)propanamide (PubChem CID 51725386) has the molecular formula C15H25N3O4S and a molecular weight of 343.45 g/mol. Its IUPAC name is (2R)-2-[3-(methanesulfonamido)-4-methoxyanilino]-N-(2-methylpropyl)propanamide.
| Compound Name | (2R)-2-[3-(methanesulfonamido)-4-methoxyanilino]-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 51725386 |
| Molecular Formula | C15H25N3O4S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (2R)-2-[3-(methanesulfonamido)-4-methoxyanilino]-N-(2-methylpropyl)propanamide |
| SMILES | COc1ccc(N[C@H](C)C(=O)NCC(C)C)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C15H25N3O4S/c1-10(2)9-16-15(19)11(3)17-12-6-7-14(22-4)13(8-12)18-23(5,20)21/h6-8,10-11,17-18H,9H2,1-5H3,(H,16,19)/t11-/m1/s1 |
| InChIKey | KEHNAMQFNFUYPQ-LLVKDONJSA-N |
| XLogP | 1.64 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|