C19H26N2O5S2 — CID 55559864
N-[3-(methanesulfonamido)-4-methoxyphenyl]-4-(3-methylbutyl)benzenesulfonamide (PubChem CID 55559864) has the molecular formula C19H26N2O5S2 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-[3-(methanesulfonamido)-4-methoxyphenyl]-4-(3-methylbutyl)benzenesulfonamide.
| Compound Name | N-[3-(methanesulfonamido)-4-methoxyphenyl]-4-(3-methylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55559864 |
| Molecular Formula | C19H26N2O5S2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | N-[3-(methanesulfonamido)-4-methoxyphenyl]-4-(3-methylbutyl)benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(CCC(C)C)cc2)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C19H26N2O5S2/c1-14(2)5-6-15-7-10-17(11-8-15)28(24,25)20-16-9-12-19(26-3)18(13-16)21-27(4,22)23/h7-14,20-21H,5-6H2,1-4H3 |
| InChIKey | ADOHJLVBFMHILG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |