C19H26N2O4S — CID 112985152
3,4-dimethoxy-N-[4-(3-methylbutylamino)phenyl]benzenesulfonamide (PubChem CID 112985152) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[4-(3-methylbutylamino)phenyl]benzenesulfonamide.
| Compound Name | 3,4-dimethoxy-N-[4-(3-methylbutylamino)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112985152 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 3,4-dimethoxy-N-[4-(3-methylbutylamino)phenyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(NCCC(C)C)cc2)cc1OC |
| InChI | InChI=1S/C19H26N2O4S/c1-14(2)11-12-20-15-5-7-16(8-6-15)21-26(22,23)17-9-10-18(24-3)19(13-17)25-4/h5-10,13-14,20-21H,11-12H2,1-4H3 |
| InChIKey | MWYCEKKQBAUYCQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |