C18H24N2O5S — CID 112981118
3,4-dimethoxy-N-[4-(3-methoxypropylamino)phenyl]benzenesulfonamide (PubChem CID 112981118) has the molecular formula C18H24N2O5S and a molecular weight of 380.47 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[4-(3-methoxypropylamino)phenyl]benzenesulfonamide.
| Compound Name | 3,4-dimethoxy-N-[4-(3-methoxypropylamino)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112981118 |
| Molecular Formula | C18H24N2O5S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 3,4-dimethoxy-N-[4-(3-methoxypropylamino)phenyl]benzenesulfonamide |
| SMILES | COCCCNc1ccc(NS(=O)(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C18H24N2O5S/c1-23-12-4-11-19-14-5-7-15(8-6-14)20-26(21,22)16-9-10-17(24-2)18(13-16)25-3/h5-10,13,19-20H,4,11-12H2,1-3H3 |
| InChIKey | BETHCVOXGOGRII-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|