C17H21ClN2O4S2 — CID 39329194
N-[3-chloro-4-(methanesulfonamido)phenyl]-4-(2-methylpropyl)benzenesulfonamide (PubChem CID 39329194) has the molecular formula C17H21ClN2O4S2 and a molecular weight of 416.95 g/mol. Its IUPAC name is N-[3-chloro-4-(methanesulfonamido)phenyl]-4-(2-methylpropyl)benzenesulfonamide.
| Compound Name | N-[3-chloro-4-(methanesulfonamido)phenyl]-4-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 39329194 |
| Molecular Formula | C17H21ClN2O4S2 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | N-[3-chloro-4-(methanesulfonamido)phenyl]-4-(2-methylpropyl)benzenesulfonamide |
| SMILES | CC(C)Cc1ccc(S(=O)(=O)Nc2ccc(NS(C)(=O)=O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H21ClN2O4S2/c1-12(2)10-13-4-7-15(8-5-13)26(23,24)19-14-6-9-17(16(18)11-14)20-25(3,21)22/h4-9,11-12,19-20H,10H2,1-3H3 |
| InChIKey | GOQXXRJJBPJHPJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'} |
|---|