C18H23ClN2O4S2 — CID 35545776
N-[3-chloro-4-(methanesulfonamido)phenyl]-4-(3-methylbutyl)benzenesulfonamide (PubChem CID 35545776) has the molecular formula C18H23ClN2O4S2 and a molecular weight of 430.98 g/mol. Its IUPAC name is N-[3-chloro-4-(methanesulfonamido)phenyl]-4-(3-methylbutyl)benzenesulfonamide.
| Compound Name | N-[3-chloro-4-(methanesulfonamido)phenyl]-4-(3-methylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 35545776 |
| Molecular Formula | C18H23ClN2O4S2 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | N-[3-chloro-4-(methanesulfonamido)phenyl]-4-(3-methylbutyl)benzenesulfonamide |
| SMILES | CC(C)CCc1ccc(S(=O)(=O)Nc2ccc(NS(C)(=O)=O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H23ClN2O4S2/c1-13(2)4-5-14-6-9-16(10-7-14)27(24,25)20-15-8-11-18(17(19)12-15)21-26(3,22)23/h6-13,20-21H,4-5H2,1-3H3 |
| InChIKey | HAYFUPGBUWSDSZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'} |
|---|