C18H20N4O4S — CID 37329403
N-[2-methoxy-5-[[(1S)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]amino]phenyl]methanesulfonamide (PubChem CID 37329403) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-[2-methoxy-5-[[(1S)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]amino]phenyl]methanesulfonamide.
| Compound Name | N-[2-methoxy-5-[[(1S)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]amino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 37329403 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-[2-methoxy-5-[[(1S)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]amino]phenyl]methanesulfonamide |
| SMILES | COc1ccc(N[C@@H](C)c2nnc(-c3ccccc3)o2)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C18H20N4O4S/c1-12(17-20-21-18(26-17)13-7-5-4-6-8-13)19-14-9-10-16(25-2)15(11-14)22-27(3,23)24/h4-12,19,22H,1-3H3/t12-/m0/s1 |
| InChIKey | LTOHJTCWXKKDPP-LBPRGKRZSA-N |
| XLogP | 3.29 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|