C19H22N4O4S — CID 42896591
2-methoxy-N,N-dimethyl-5-[1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethylamino]benzenesulfonamide (PubChem CID 42896591) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is 2-methoxy-N,N-dimethyl-5-[1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethylamino]benzenesulfonamide.
| Compound Name | 2-methoxy-N,N-dimethyl-5-[1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 42896591 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-methoxy-N,N-dimethyl-5-[1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethylamino]benzenesulfonamide |
| SMILES | COc1ccc(NC(C)c2nnc(-c3ccccc3)o2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C19H22N4O4S/c1-13(18-21-22-19(27-18)14-8-6-5-7-9-14)20-15-10-11-16(26-4)17(12-15)28(24,25)23(2)3/h5-13,20H,1-4H3 |
| InChIKey | XKSFCBPAAMJVRK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|