C17H14F3N3O2 — CID 32509192
N-[(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]-4-(trifluoromethoxy)aniline (PubChem CID 32509192) has the molecular formula C17H14F3N3O2 and a molecular weight of 349.31 g/mol. Its IUPAC name is N-[(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]-4-(trifluoromethoxy)aniline.
| Compound Name | N-[(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 32509192 |
| Molecular Formula | C17H14F3N3O2 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-[(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]-4-(trifluoromethoxy)aniline |
| SMILES | C[C@@H](Nc1ccc(OC(F)(F)F)cc1)c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C17H14F3N3O2/c1-11(15-22-23-16(24-15)12-5-3-2-4-6-12)21-13-7-9-14(10-8-13)25-17(18,19)20/h2-11,21H,1H3/t11-/m1/s1 |
| InChIKey | UURCNCSNKSZYML-LLVKDONJSA-N |
| XLogP | 4.81 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|