C19H21N3O2 — CID 25357173
4-ethoxy-N-[(1R)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl]aniline (PubChem CID 25357173) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 4-ethoxy-N-[(1R)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl]aniline.
| Compound Name | 4-ethoxy-N-[(1R)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl]aniline |
|---|---|
| PubChem CID | 25357173 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 4-ethoxy-N-[(1R)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl]aniline |
| SMILES | CCOc1ccc(N[C@H](C)c2nnc(-c3ccc(C)cc3)o2)cc1 |
| InChI | InChI=1S/C19H21N3O2/c1-4-23-17-11-9-16(10-12-17)20-14(3)18-21-22-19(24-18)15-7-5-13(2)6-8-15/h5-12,14,20H,4H2,1-3H3/t14-/m1/s1 |
| InChIKey | NTEDXELLFDODOQ-CQSZACIVSA-N |
| XLogP | 4.62 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|